ChemNet > CAS > 1135-23-5 3-(4-Hydroxymethyl)propionic acid
1135-23-5 3-(4-Hydroxymethyl)propionic acid
| Ονομασ?α του προ??ντο? |
3-(4-Hydroxymethyl)propionic acid |
| Αγγλικ? ?νομα |
3-(4-Hydroxymethyl)propionic acid; 3-(4-Hydroxy-3-methoxyphenyl)propionic acid; Hydroferulic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoic acid; 3-(4-hydroxy-3-methoxyphenyl)propanoate |
| MF |
C10H11O4 |
| Μοριακ? β?ρο? |
195.1925 |
| InChI |
InChI=1/C10H12O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2,4,6,11H,3,5H2,1H3,(H,12,13)/p-1 |
| CAS ΟΧΙ |
1135-23-5 |
| EINECS |
214-489-5 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
89-90℃ |
| Σημε?ο βρασμο? |
376.5°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
151.1°C |
| Π?εση ατμ?ν |
2.45E-06mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|