4368-06-3 3-Hydroxybutyronitrile
| ?? ????? |
3-Hydroxybutyronitrile |
| ?? ????? |
3-Hydroxybutyronitrile;beta-Hydroxybutyronitrile; 3-hydroxybutanenitrile |
| ????????? ??????? |
C4H7NO |
| ???? ???????? |
85.1045 |
| InChI |
InChI=1/C4H7NO/c1-4(6)2-3-5/h4,6H,2H2,1H3 |
| ???? CAS |
4368-06-3 |
| EINECS |
224-457-2 |
| ???? ???????? |
|
| ?????? |
0.991g/cm3 |
| ????? ????? |
217.3°C at 760 mmHg |
| ???? ????? |
1.425 |
| ????? ???? |
85.2°C |
| ??? ???? |
0.0286mmHg at 25°C |
| Hazard ?????? |
Xn:Harmful;
|
| ??????? ???? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ?????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|