4368-06-3 3-Hydroxybutyronitrile
| Ονομασ?α του προ??ντο? |
3-Hydroxybutyronitrile |
| Αγγλικ? ?νομα |
3-Hydroxybutyronitrile;beta-Hydroxybutyronitrile; 3-hydroxybutanenitrile |
| MF |
C4H7NO |
| Μοριακ? β?ρο? |
85.1045 |
| InChI |
InChI=1/C4H7NO/c1-4(6)2-3-5/h4,6H,2H2,1H3 |
| CAS ΟΧΙ |
4368-06-3 |
| EINECS |
224-457-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
0.991g/cm3 |
| Σημε?ο βρασμο? |
217.3°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.425 |
| Σημε?ο αν?φλεξη? |
85.2°C |
| Π?εση ατμ?ν |
0.0286mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|