4368-06-3 3-Hydroxybutyronitrile
| product Name |
3-Hydroxybutyronitrile |
| CAS No |
4368-06-3 |
| Synonyms |
beta-Hydroxybutyronitrile; 3-hydroxybutanenitrile |
| Molecular Formula |
C4H7NO |
| Molecular Weight |
85.1045 |
| InChI |
InChI=1/C4H7NO/c1-4(6)2-3-5/h4,6H,2H2,1H3 |
| EINECS |
224-457-2 |
| Molecular Structure |
|
| Density |
0.991g/cm3 |
| Boiling point |
217.3°C at 760 mmHg |
| Refractive index |
1.425 |
| Flash point |
85.2°C |
| Vapour Pressur |
0.0286mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
| MSDS |
Material Safety Data Sheet
|
|