659-30-3 4-fluorophenylurea
| termék neve |
4-fluorophenylurea |
| Angol név |
4-fluorophenylurea;Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
| MF |
C10H8FN |
| Molekulat?meg |
161.1756 |
| InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
| CAS-szám |
659-30-3 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.07g/cm3 |
| Forráspont |
229.7°C at 760 mmHg |
| T?résmutató |
1.543 |
| Gyulladáspont |
92.7°C |
| G?znyomás |
0.104mmHg at 25°C |
| Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|