659-30-3 4-fluorophenylurea
| Produkt-Name |
4-fluorophenylurea |
| Englischer Name |
4-fluorophenylurea;Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
| Molekulare Formel |
C10H8FN |
| Molecular Weight |
161.1756 |
| InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
| CAS Registry Number |
659-30-3 |
| Molecular Structure |
|
| Dichte |
1.07g/cm3 |
| Siedepunkt |
229.7°C at 760 mmHg |
| Brechungsindex |
1.543 |
| Flammpunkt |
92.7°C |
| Dampfdruck |
0.104mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|