659-30-3 4-fluorophenylurea
| product Name |
4-fluorophenylurea |
| CAS No |
659-30-3 |
| Synonyms |
Urea, 1-(p-fluorophenyl)-; (4-Fluorophenyl)urea; 1-(p-Fluorophenyl)urea; 4-12-00-01108 (Beilstein Handbook Reference); BRN 2090131; 1-(4-fluorophenyl)urea; 1-(4-fluorophenyl)-1H-pyrrole |
| Molecular Formula |
C10H8FN |
| Molecular Weight |
161.1756 |
| InChI |
InChI=1/C10H8FN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H |
| Molecular Structure |
|
| Density |
1.07g/cm3 |
| Boiling point |
229.7°C at 760 mmHg |
| Refractive index |
1.543 |
| Flash point |
92.7°C |
| Vapour Pressur |
0.104mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |
| Contact |
Andy Yang |
| Telephone |
+86-21-50933265 |
| Email |
andy@wesscco.com |
| Address |
No.87,Lane 1296,Jingao Road,Pudong New District,Shanghai-201206 |