698-76-0 Octanolactone
| product Name |
Octanolactone |
| CAS No |
698-76-0 |
| Synonyms |
5-Hydroxyoctanoic acid lactone; delta-Octalactone; 1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one; Delta Octalactone |
| Molecular Formula |
C8H14O2 |
| Molecular Weight |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
| EINECS |
211-820-5 |
| Molecular Structure |
|
| Density |
0.96g/cm3 |
| Boiling point |
239.8°C at 760 mmHg |
| Refractive index |
1.436 |
| Flash point |
92.2°C |
| Vapour Pressur |
0.0394mmHg at 25°C |
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
Featured China Suppliers
| Contact |
Li gainian |
| Telephone |
+86-556-8968843 |
| Email |
ligainian@anhuihuaye.com |
| Address |
Pengling Industrial Park, Qianshan, Anhui Prov.,China |
| Contact |
Karl |
| Telephone |
+86-571-85395792 +13867466880 |
| Email |
info@orchid-chem.com |
| Address |
R1812, 607, North Zhongshan Road, Hangzhou, Zhejiang, China |
| Contact |
Xu Hongbin |
| Telephone |
+86-515-86111688;86221388;86098099 |
| Email |
sales@hongtaibiochem.com |
| Address |
271 Xiangyang West Road, Jianhu County, Jiangsu province |
| Contact |
Lucky Liu |
| Telephone |
0086-15665710862 |
| Email |
sales@tzrunlong.com |
| Address |
No. 78, Fushan Road, Biomedical Industrial Park, Dawu Town, Tengzhou, Shandong, 277514 China |
| Contact |
Mr.Sunny Su |
| Telephone |
0086-573-82850871 |
| Email |
su@promocreat.com |
| Address |
604, Building 2, Hualong Plaza, Jiaxing, Zhejiang, China |