698-76-0 Octanolactone
| ?????? ?? ??? |
Octanolactone |
| ???????? ??? |
Octanolactone; 5-Hydroxyoctanoic acid lactone; delta-Octalactone; 1,5-Octanolide; 6-propyltetrahydro-2H-pyran-2-one; Delta Octalactone |
| ????? ???????? |
C8H14O2 |
| ?????? ??? |
142.1956 |
| InChI |
InChI=1/C8H14O2/c1-2-4-7-5-3-6-8(9)10-7/h7H,2-6H2,1H3 |
| ??? ??????? ?????? |
698-76-0 |
| EINECS |
211-820-5 |
| ????? ?????? |
|
| ????? |
0.96g/cm3 |
| ????? ?? ??? |
239.8°C at 760 mmHg |
| ??????? ??????? |
1.436 |
| ????? ??????? |
92.2°C |
| ????? ?? ???? |
0.0394mmHg at 25°C |
| ???? ?? ??? |
R36/38:Irritating to eyes and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|