2425-85-6 Toluidine Red
| product Name |
Toluidine Red |
| CAS No |
2425-85-6 |
| Synonyms |
C.I. 12120; C.I. Pigment Red 3; 1-(4-Methyl-2-nitrophenylazo)-2-naphthol; Pigment Red 3; 1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one; (1Z)-1-[(4-methyl-2-nitrophenyl)hydrazono]naphthalen-2(1H)-one |
| Molecular Formula |
C17H13N3O3 |
| Molecular Weight |
307.3034 |
| InChI |
InChI=1/C17H13N3O3/c1-11-6-8-14(15(10-11)20(22)23)18-19-17-13-5-3-2-4-12(13)7-9-16(17)21/h2-10,18H,1H3/b19-17- |
| EINECS |
219-372-2 |
| Molecular Structure |
|
| Density |
1.32g/cm3 |
| Melting point |
270-272℃ |
| Boiling point |
491.9°C at 760 mmHg |
| Refractive index |
1.66 |
| Flash point |
251.3°C |
| Vapour Pressur |
8.02E-10mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R40:Possible risks of irreversible effects.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
| MSDS |
Material Safety Data Sheet
|
|
Featured China Suppliers
| Telephone |
+86-571-88383188;86970388;+49-211-550203-21 |
| Email |
sales@dragon-chem.com |
| Address |
16/Fl., Tower B, Qingchun Development Building, 66 East Qingchun Rd., Hangzhou, China |
| Telephone |
+86-571-82890001 |
| Email |
shengda@shengda-chem.com |
| Address |
Nanyang Economical Development Zone, Xiaoshan, Hangzhou, Zhejiang, China |
| Contact |
Enguang Ma |
| Telephone |
86-0571-82775476 |
| Email |
sales@multicolorchemical.com |
| Address |
6th Floor,Block 4,Orient International Plaza,No.60 North Shixin Road,Xiaoshan, Hangzhou,China |
| Telephone |
+86-21-62744350 62598819 |
| Email |
marketing@kelcochem.com |
| Address |
Rm 601, Tianshan Manshion, No. 30, Tian Shan Road,Shanghai, 200336, China. |
| Contact |
Zack Lin |
| Telephone |
+86-571-57138818/19/21/22/15, 82123886 |
| Email |
sales@qj-chem.com.cn |
| Address |
Qianjin Industrial Park , Xiaoshan, Hangzhou, Zhejiang, China |