878-00-2 4-Acetoxybenzaldehyde
| ürün Ad? |
4-Acetoxybenzaldehyde |
| ingilizce ad? |
4-Acetoxybenzaldehyde; 4-Formylphenyl acetate |
| Moleküler Formülü |
C9H8O3 |
| Molekül A??rl??? |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
| CAS kay?t numaras? |
878-00-2 |
| EINECS |
212-898-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.183g/cm3 |
| Kaynama noktas? |
275°C at 760 mmHg |
| K?r?lma indisi |
1.552 |
| Alevlenme noktas? |
119.4°C |
| Buhar bas?nc? |
0.00522mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|