878-00-2 4-Acetoxybenzaldehyde
| Naam product |
4-Acetoxybenzaldehyde |
| Engelse naam |
4-Acetoxybenzaldehyde; 4-Formylphenyl acetate |
| MF |
C9H8O3 |
| Molecuulgewicht |
164.158 |
| InChI |
InChI=1/C9H8O3/c1-7(11)12-9-4-2-8(6-10)3-5-9/h2-6H,1H3 |
| CAS-nummer |
878-00-2 |
| EINECS |
212-898-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.183g/cm3 |
| Kookpunt |
275°C at 760 mmHg |
| Brekingsindex |
1.552 |
| Vlampunt |
119.4°C |
| Dampdruk |
0.00522mmHg at 25°C |
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|