ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
| ürün Ad? |
4'-Hydroxy-2'-methylacetophenone |
| ingilizce ad? |
4'-Hydroxy-2'-methylacetophenone; 2'-Methyl-4'-hydroxyacetophenone |
| Moleküler Formülü |
C9H10O2 |
| Molekül A??rl??? |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
| CAS kay?t numaras? |
875-59-2 |
| EINECS |
212-874-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.106g/cm3 |
| Ergime noktas? |
127-132℃ |
| Kaynama noktas? |
313°C at 760 mmHg |
| K?r?lma indisi |
1.546 |
| Alevlenme noktas? |
127.9°C |
| Buhar bas?nc? |
0.000278mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|