ChemNet > CAS > 875-59-2 4'-Hydroxy-2'-methylacetophenone
875-59-2 4'-Hydroxy-2'-methylacetophenone
| Ονομασ?α του προ??ντο? |
4'-Hydroxy-2'-methylacetophenone |
| Αγγλικ? ?νομα |
4'-Hydroxy-2'-methylacetophenone; 2'-Methyl-4'-hydroxyacetophenone |
| MF |
C9H10O2 |
| Μοριακ? β?ρο? |
150.1745 |
| InChI |
InChI=1/C9H10O2/c1-6-5-8(11)3-4-9(6)7(2)10/h3-5,11H,1-2H3 |
| CAS ΟΧΙ |
875-59-2 |
| EINECS |
212-874-2 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.106g/cm3 |
| Σημε?ο τ?ξη? |
127-132℃ |
| Σημε?ο βρασμο? |
313°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.546 |
| Σημε?ο αν?φλεξη? |
127.9°C |
| Π?εση ατμ?ν |
0.000278mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xi:Irritant;
|
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|