ChemNet > CAS > 72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane
| ürün Ad? |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
| ingilizce ad? |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
| Moleküler Formülü |
C14H10Cl4 |
| Molekül A??rl??? |
320.04 |
| InChI |
InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| CAS kay?t numaras? |
72-54-8 |
| EINECS |
200-783-0 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
109-111℃ |
| Tehlike Sembolleri |
T:Toxic;
|
| Risk Kodlar? |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|