ChemNet > CAS > 72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane
72-54-8 2,2-Bis(4-chlorophenyl)-1,1-dichloroethane
| Nama produk |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane |
| Nama bahasa Inggris |
2,2-Bis(4-chlorophenyl)-1,1-dichloroethane; |
| MF |
C14H10Cl4 |
| Berat Molekul |
320.04 |
| InChI |
InChI=1/C14H10Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8,13-14H |
| CAS NO |
72-54-8 |
| EINECS |
200-783-0 |
| Struktur Molekul |
|
| Titik lebur |
109-111℃ |
| Simbol bahaya |
T:Toxic;
|
| Kode Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Deskripsi |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|