ChemNet > CAS > 701-70-2 Alpha-Ethylphenethyl alcohol
701-70-2 Alpha-Ethylphenethyl alcohol
| ürün Ad? |
Alpha-Ethylphenethyl alcohol |
| ingilizce ad? |
Alpha-Ethylphenethyl alcohol; 1-Phenyl-2-butanol; 1-phenylbutan-2-ol; (2S)-1-phenylbutan-2-ol; (2R)-1-phenylbutan-2-ol |
| Moleküler Formülü |
C10H14O |
| Molekül A??rl??? |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
| CAS kay?t numaras? |
701-70-2 |
| EINECS |
211-858-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.98g/cm3 |
| Kaynama noktas? |
226.6°C at 760 mmHg |
| K?r?lma indisi |
1.52 |
| Alevlenme noktas? |
100°C |
| Buhar bas?nc? |
0.0459mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|