ChemNet > CAS > 701-70-2 Alpha-Ethylphenethyl alcohol
701-70-2 Alpha-Ethylphenethyl alcohol
| Nome do produto |
Alpha-Ethylphenethyl alcohol |
| Nome em inglês |
Alpha-Ethylphenethyl alcohol; 1-Phenyl-2-butanol; 1-phenylbutan-2-ol; (2S)-1-phenylbutan-2-ol; (2R)-1-phenylbutan-2-ol |
| Fórmula molecular |
C10H14O |
| Peso Molecular |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-2-10(11)8-9-6-4-3-5-7-9/h3-7,10-11H,2,8H2,1H3/t10-/m1/s1 |
| CAS Registry Number |
701-70-2 |
| EINECS |
211-858-2 |
| Estrutura Molecular |
|
| Densidade |
0.98g/cm3 |
| Ponto de ebuli??o |
226.6°C at 760 mmHg |
| índice de refra??o |
1.52 |
| O ponto de inflama??o |
100°C |
| Press?o de vapor |
0.0459mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|