70-69-9 4'-Aminopropiophenone
| ürün Ad? |
4'-Aminopropiophenone |
| ingilizce ad? |
4'-Aminopropiophenone; 4-Aminopropiophenone; para-Aminopropiophenone; p-Aminopropiophenone |
| Moleküler Formülü |
C9H11NO |
| Molekül A??rl??? |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| CAS kay?t numaras? |
70-69-9 |
| EINECS |
200-742-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.067g/cm3 |
| Ergime noktas? |
137-143℃ |
| Kaynama noktas? |
305.8°C at 760 mmHg |
| K?r?lma indisi |
1.559 |
| Alevlenme noktas? |
138.7°C |
| Buhar bas?nc? |
0.000805mmHg at 25°C |
| Tehlike Sembolleri |
T:Toxic;
|
| Risk Kodlar? |
R25:Toxic if swallowed.;
|
| Güvenlik A??klamas? |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|