70-69-9 4'-Aminopropiophenone
| Nazwa produktu: |
4'-Aminopropiophenone |
| Angielska nazwa |
4'-Aminopropiophenone; 4-Aminopropiophenone; para-Aminopropiophenone; p-Aminopropiophenone |
| MF |
C9H11NO |
| Masie cz?steczkowej |
149.1897 |
| InChI |
InChI=1/C9H11NO/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6H,2,10H2,1H3 |
| Nr CAS |
70-69-9 |
| EINECS |
200-742-7 |
| Struktury molekularnej |
|
| G?sto?? |
1.067g/cm3 |
| Temperatura topnienia |
137-143℃ |
| Temperatura wrzenia |
305.8°C at 760 mmHg |
| Wspó?czynnik za?amania |
1.559 |
| Temperatura zap?onu |
138.7°C |
| Ci?nienie pary |
0.000805mmHg at 25°C |
| Symbole zagro?enia |
T:Toxic;
|
| Kody ryzyka |
R25:Toxic if swallowed.;
|
| Bezpieczeństwo opis |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|