698-90-8 cyclohexylurea
| ürün Ad? |
cyclohexylurea |
| ingilizce ad? |
cyclohexylurea; N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
| Moleküler Formülü |
C7H14N2O |
| Molekül A??rl??? |
142.1989 |
| InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
| CAS kay?t numaras? |
698-90-8 |
| EINECS |
211-822-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.05g/cm3 |
| Kaynama noktas? |
240.3°C at 760 mmHg |
| K?r?lma indisi |
1.5 |
| Alevlenme noktas? |
99.2°C |
| Buhar bas?nc? |
0.0381mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|