698-90-8 cyclohexylurea
| product Name |
cyclohexylurea |
| CAS No |
698-90-8 |
| Synonyms |
N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
| Molecular Formula |
C7H14N2O |
| Molecular Weight |
142.1989 |
| InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
| EINECS |
211-822-6 |
| Molecular Structure |
|
| Density |
1.05g/cm3 |
| Boiling point |
240.3°C at 760 mmHg |
| Refractive index |
1.5 |
| Flash point |
99.2°C |
| Vapour Pressur |
0.0381mmHg at 25°C |
| Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Packing |
25kgs net cardboard drum(1x20'FCL=9mts without pallet) |
| Description |
Molecular Formula: C7H14N2OCAS Number: 698-90-8Description: mp: 190-193℃Specification Appearance: white powderPurity: 97% minUrea: 0.5% max1,3-Dicyclohexylurea: 2% maxMelting point: 190-193℃Loss on drying: 0.5% max |
| Telephone |
+86-21-33927743;33927342 |
| Email |
info@hebeismart.com |
| Address |
Room 2702,Information Tower,1403 Minsheng Road,Shanghai,200135,China. |