637-78-5 Isopropyl propionate
| ürün Ad? |
Isopropyl propionate |
| ingilizce ad? |
Isopropyl propionate; Isopropyl propionate, (Propionic acid isopropyl ester); Propionic acid isopropyl ester; propan-2-yl propanoate |
| Moleküler Formülü |
C6H12O2 |
| Molekül A??rl??? |
116.1583 |
| InChI |
InChI=1/C6H12O2/c1-4-6(7)8-5(2)3/h5H,4H2,1-3H3 |
| CAS kay?t numaras? |
637-78-5 |
| EINECS |
211-300-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.883g/cm3 |
| Kaynama noktas? |
112.6°C at 760 mmHg |
| K?r?lma indisi |
1.395 |
| Alevlenme noktas? |
19.4°C |
| Buhar bas?nc? |
21.6mmHg at 25°C |
| Risk Kodlar? |
R11:Highly flammable.;
|
| Güvenlik A??klamas? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24:Avoid contact with skin.;
S29:Do not empty into drains.;
S33:Take precautionary measures against static discharges.;
|
|