637-78-5 Isopropyl propionate
| ??? ?????? |
Isopropyl propionate |
| ????? ??????????? |
Isopropyl propionate; Isopropyl propionate, (Propionic acid isopropyl ester); Propionic acid isopropyl ester; propan-2-yl propanoate |
| ?????? ???????? |
C6H12O2 |
| ????? ??????? ??????? |
116.1583 |
| InChI |
InChI=1/C6H12O2/c1-4-6(7)8-5(2)3/h5H,4H2,1-3H3 |
| ?????????? ???????? ??????? |
637-78-5 |
| ???????? ????????? ??? |
211-300-8 |
| ???? ?????? |
|
| ????? |
0.883g/cm3 |
| ???? ??????? |
112.6°C at 760 mmHg |
| ????? ???????? |
1.395 |
| ???? ?????? |
19.4°C |
| ??? ?????? |
21.6mmHg at 25°C |
| ??? ????????? |
R11:Highly flammable.;
|
| ???? ????? |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24:Avoid contact with skin.;
S29:Do not empty into drains.;
S33:Take precautionary measures against static discharges.;
|
|