636-93-1 2-methoxy-5-nitrophenol
| ürün Ad? |
2-methoxy-5-nitrophenol |
| ingilizce ad? |
2-methoxy-5-nitrophenol; 5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene); 3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol; 5-Nitroguaiacol |
| Moleküler Formülü |
C7H7NO4 |
| Molekül A??rl??? |
169.1348 |
| InChI |
InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
| CAS kay?t numaras? |
636-93-1 |
| EINECS |
211-269-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.367g/cm3 |
| Ergime noktas? |
103-107℃ |
| Kaynama noktas? |
291°C at 760 mmHg |
| K?r?lma indisi |
1.583 |
| Alevlenme noktas? |
147.1°C |
| Buhar bas?nc? |
0.00115mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|