636-93-1 2-methoxy-5-nitrophenol
| Nome do produto |
2-methoxy-5-nitrophenol |
| Nome em inglês |
2-methoxy-5-nitrophenol; 5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene); 3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol; 5-Nitroguaiacol |
| Fórmula molecular |
C7H7NO4 |
| Peso Molecular |
169.1348 |
| InChI |
InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
| CAS Registry Number |
636-93-1 |
| EINECS |
211-269-0 |
| Estrutura Molecular |
|
| Densidade |
1.367g/cm3 |
| Ponto de fus?o |
103-107℃ |
| Ponto de ebuli??o |
291°C at 760 mmHg |
| índice de refra??o |
1.583 |
| O ponto de inflama??o |
147.1°C |
| Press?o de vapor |
0.00115mmHg at 25°C |
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|