625-48-9 2-Nitroethanol
| ürün Ad? |
2-Nitroethanol |
| ingilizce ad? |
2-Nitroethanol;1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| Moleküler Formülü |
C2H5NO3 |
| Molekül A??rl??? |
91.07 |
| InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| CAS kay?t numaras? |
625-48-9 |
| EINECS |
210-895-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.267g/cm3 |
| Kaynama noktas? |
193.8°C at 760 mmHg |
| K?r?lma indisi |
1.438 |
| Alevlenme noktas? |
113.8°C |
| Buhar bas?nc? |
0.12mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|