625-48-9 2-Nitroethanol
| Ονομασ?α του προ??ντο? |
2-Nitroethanol |
| Αγγλικ? ?νομα |
2-Nitroethanol;1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| MF |
C2H5NO3 |
| Μοριακ? β?ρο? |
91.07 |
| InChI |
InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| CAS ΟΧΙ |
625-48-9 |
| EINECS |
210-895-1 |
| Μοριακ? δομ? |
|
| Πυκν?τητα |
1.267g/cm3 |
| Σημε?ο βρασμο? |
193.8°C at 760 mmHg |
| Δε?κτη? δι?θλαση? |
1.438 |
| Σημε?ο αν?φλεξη? |
113.8°C |
| Π?εση ατμ?ν |
0.12mmHg at 25°C |
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|