ChemNet > CAS > 618-71-3 Ethyl 3,5-dinitrobenzoate
618-71-3 Ethyl 3,5-dinitrobenzoate
| ürün Ad? |
Ethyl 3,5-dinitrobenzoate |
| ingilizce ad? |
Ethyl 3,5-dinitrobenzoate; 3,5-Dinitrobenzoic acid ethyl ester |
| Moleküler Formülü |
C9H8N2O6 |
| Molekül A??rl??? |
240.1696 |
| InChI |
InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
| CAS kay?t numaras? |
618-71-3 |
| EINECS |
210-559-4 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.433g/cm3 |
| Ergime noktas? |
94-95℃ |
| Kaynama noktas? |
367.1°C at 760 mmHg |
| K?r?lma indisi |
1.58 |
| Alevlenme noktas? |
171.8°C |
| Buhar bas?nc? |
1.39E-05mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|