ChemNet > CAS > 618-71-3 Ethyl 3,5-dinitrobenzoate
618-71-3 Ethyl 3,5-dinitrobenzoate
| Produkt-Name |
Ethyl 3,5-dinitrobenzoate |
| Englischer Name |
Ethyl 3,5-dinitrobenzoate; 3,5-Dinitrobenzoic acid ethyl ester |
| Molekulare Formel |
C9H8N2O6 |
| Molecular Weight |
240.1696 |
| InChI |
InChI=1/C9H8N2O6/c1-2-17-9(12)6-3-7(10(13)14)5-8(4-6)11(15)16/h3-5H,2H2,1H3 |
| CAS Registry Number |
618-71-3 |
| EINECS |
210-559-4 |
| Molecular Structure |
|
| Dichte |
1.433g/cm3 |
| Schmelzpunkt |
94-95℃ |
| Siedepunkt |
367.1°C at 760 mmHg |
| Brechungsindex |
1.58 |
| Flammpunkt |
171.8°C |
| Dampfdruck |
1.39E-05mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|