613-80-9 di-2-naphthyl ether
| ürün Ad? |
di-2-naphthyl ether |
| ingilizce ad? |
di-2-naphthyl ether; Dinaphthylether; 2,2-Dinaphthyl ether; 2-Naphthyl ether; 2,2'-oxydinaphthalene |
| Moleküler Formülü |
C20H14O |
| Molekül A??rl??? |
270.3246 |
| InChI |
InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| CAS kay?t numaras? |
613-80-9 |
| EINECS |
210-356-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.184g/cm3 |
| Kaynama noktas? |
449.9°C at 760 mmHg |
| K?r?lma indisi |
1.701 |
| Alevlenme noktas? |
226.1°C |
| Buhar bas?nc? |
7.3E-08mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|