613-80-9 di-2-naphthyl ether
| Produkt-Name |
di-2-naphthyl ether |
| Englischer Name |
di-2-naphthyl ether; Dinaphthylether; 2,2-Dinaphthyl ether; 2-Naphthyl ether; 2,2'-oxydinaphthalene |
| Molekulare Formel |
C20H14O |
| Molecular Weight |
270.3246 |
| InChI |
InChI=1/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H |
| CAS Registry Number |
613-80-9 |
| EINECS |
210-356-0 |
| Molecular Structure |
|
| Dichte |
1.184g/cm3 |
| Siedepunkt |
449.9°C at 760 mmHg |
| Brechungsindex |
1.701 |
| Flammpunkt |
226.1°C |
| Dampfdruck |
7.3E-08mmHg at 25°C |
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|