610-96-8 Methyl 2-chlorobenzoate
| ürün Ad? |
Methyl 2-chlorobenzoate |
| ingilizce ad? |
Methyl 2-chlorobenzoate; Chlorobenzoic acid methyl ester; O-Chlorobenzoic Acid Methyl Ester; 2-Chlorobenzoic Acid Methyl Ester |
| Moleküler Formülü |
C8H7ClO2 |
| Molekül A??rl??? |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| CAS kay?t numaras? |
610-96-8 |
| EINECS |
210-242-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.224g/cm3 |
| Kaynama noktas? |
225.4°C at 760 mmHg |
| K?r?lma indisi |
1.528 |
| Alevlenme noktas? |
101.7°C |
| Buhar bas?nc? |
0.0868mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:;
|
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|