610-96-8 Methyl 2-chlorobenzoate
| Nama produk |
Methyl 2-chlorobenzoate |
| Nama Inggeris |
Methyl 2-chlorobenzoate; Chlorobenzoic acid methyl ester; O-Chlorobenzoic Acid Methyl Ester; 2-Chlorobenzoic Acid Methyl Ester |
| MF |
C8H7ClO2 |
| Berat Molekul |
170.593 |
| InChI |
InChI=1/C8H7ClO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| CAS NO |
610-96-8 |
| EINECS |
210-242-0 |
| Struktur Molekul |
|
| Kepadatan |
1.224g/cm3 |
| Titik didih |
225.4°C at 760 mmHg |
| Indeks bias |
1.528 |
| Titik nyala |
101.7°C |
| Tekanan wap |
0.0868mmHg at 25°C |
| Cinta bahaya |
Xi:Irritant;
|
| Kod Risiko |
R36/37/38:;
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|