535-32-0 D-Ethionine
| ürün Ad? |
D-Ethionine |
| ingilizce ad? |
D-Ethionine; D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
| Moleküler Formülü |
C6H13NO2S |
| Molekül A??rl??? |
163.2379 |
| InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| CAS kay?t numaras? |
535-32-0 |
| EINECS |
208-612-1 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.164g/cm3 |
| Ergime noktas? |
278℃ |
| Kaynama noktas? |
310.4°C at 760 mmHg |
| K?r?lma indisi |
1.523 |
| Alevlenme noktas? |
141.5°C |
| Buhar bas?nc? |
0.000133mmHg at 25°C |
| Risk Kodlar? |
R40:Possible risks of irreversible effects.;
|
| Güvenlik A??klamas? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|