535-32-0 D-Ethionine
| ?????? ?? ??? |
D-Ethionine |
| ???????? ??? |
D-Ethionine; D-2-Amino-4-(ethylthio)butyric acid; S-ethyl-D-homocysteine |
| ????? ???????? |
C6H13NO2S |
| ?????? ??? |
163.2379 |
| InChI |
InChI=1/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m1/s1 |
| ??? ??????? ?????? |
535-32-0 |
| EINECS |
208-612-1 |
| ????? ?????? |
|
| ????? |
1.164g/cm3 |
| ?????? |
278℃ |
| ????? ?? ??? |
310.4°C at 760 mmHg |
| ??????? ??????? |
1.523 |
| ????? ??????? |
141.5°C |
| ????? ?? ???? |
0.000133mmHg at 25°C |
| ???? ?? ??? |
R40:Possible risks of irreversible effects.;
|
| ??????? ????? |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|