5332-96-7 4-Nitrophenylacetone
| ürün Ad? |
4-Nitrophenylacetone |
| ingilizce ad? |
4-Nitrophenylacetone; 1-(4-Nitrophenyl)-2-propanone; 1-(4-nitrophenyl)propan-2-one |
| Moleküler Formülü |
C9H9NO3 |
| Molekül A??rl??? |
179.1727 |
| InChI |
InChI=1/C9H9NO3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3 |
| CAS kay?t numaras? |
5332-96-7 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.212g/cm3 |
| Ergime noktas? |
63-64℃ |
| Kaynama noktas? |
307.5°C at 760 mmHg |
| K?r?lma indisi |
1.549 |
| Alevlenme noktas? |
146.4°C |
| Buhar bas?nc? |
0.000724mmHg at 25°C |
| Güvenlik A??klamas? |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|