5332-96-7 4-Nitrophenylacetone
| Nama produk |
4-Nitrophenylacetone |
| Nama bahasa Inggris |
4-Nitrophenylacetone; 1-(4-Nitrophenyl)-2-propanone; 1-(4-nitrophenyl)propan-2-one |
| MF |
C9H9NO3 |
| Berat Molekul |
179.1727 |
| InChI |
InChI=1/C9H9NO3/c1-7(11)6-8-2-4-9(5-3-8)10(12)13/h2-5H,6H2,1H3 |
| CAS NO |
5332-96-7 |
| Struktur Molekul |
|
| Kepadatan |
1.212g/cm3 |
| Titik lebur |
63-64℃ |
| Titik didih |
307.5°C at 760 mmHg |
| Indeks bias |
1.549 |
| Titik nyala |
146.4°C |
| Tekanan uap |
0.000724mmHg at 25°C |
| Keselamatan Deskripsi |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|