4906-24-5 3-Acetoxy-2-butanone
| ürün Ad? |
3-Acetoxy-2-butanone |
| ingilizce ad? |
3-Acetoxy-2-butanone; Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone; 2-Acetoxyl-3-butanone |
| Moleküler Formülü |
C6H10O3 |
| Molekül A??rl??? |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| CAS kay?t numaras? |
4906-24-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.012g/cm3 |
| Kaynama noktas? |
163.4°C at 760 mmHg |
| K?r?lma indisi |
1.406 |
| Alevlenme noktas? |
56.6°C |
| Buhar bas?nc? |
2.07mmHg at 25°C |
| Risk Kodlar? |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|