4906-24-5 3-Acetoxy-2-butanone
| Nome do produto |
3-Acetoxy-2-butanone |
| Nome em inglês |
3-Acetoxy-2-butanone; Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone; 2-Acetoxyl-3-butanone |
| Fórmula molecular |
C6H10O3 |
| Peso Molecular |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| CAS Registry Number |
4906-24-5 |
| Estrutura Molecular |
|
| Densidade |
1.012g/cm3 |
| Ponto de ebuli??o |
163.4°C at 760 mmHg |
| índice de refra??o |
1.406 |
| O ponto de inflama??o |
56.6°C |
| Press?o de vapor |
2.07mmHg at 25°C |
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|