455-37-8 3-fluorobenzamide
| ürün Ad? |
3-fluorobenzamide |
| ingilizce ad? |
3-fluorobenzamide;m-Fluorobenzamide |
| Moleküler Formülü |
C7H6FNO |
| Molekül A??rl??? |
139.127 |
| InChI |
InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
| CAS kay?t numaras? |
455-37-8 |
| EINECS |
207-247-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.238g/cm3 |
| Ergime noktas? |
129-132℃ |
| Kaynama noktas? |
238.4°C at 760 mmHg |
| K?r?lma indisi |
1.538 |
| Alevlenme noktas? |
98°C |
| Buhar bas?nc? |
0.0426mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|