455-37-8 3-fluorobenzamide
| Nome do produto |
3-fluorobenzamide |
| Nome em inglês |
3-fluorobenzamide;m-Fluorobenzamide |
| Fórmula molecular |
C7H6FNO |
| Peso Molecular |
139.127 |
| InChI |
InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
| CAS Registry Number |
455-37-8 |
| EINECS |
207-247-5 |
| Estrutura Molecular |
|
| Densidade |
1.238g/cm3 |
| Ponto de fus?o |
129-132℃ |
| Ponto de ebuli??o |
238.4°C at 760 mmHg |
| índice de refra??o |
1.538 |
| O ponto de inflama??o |
98°C |
| Press?o de vapor |
0.0426mmHg at 25°C |
| Símbolos de perigo |
Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|