ChemNet > CAS > 453-11-2 1-Chloro-3-fluoro-2-propanol
453-11-2 1-Chloro-3-fluoro-2-propanol
| ürün Ad? |
1-Chloro-3-fluoro-2-propanol |
| ingilizce ad? |
1-Chloro-3-fluoro-2-propanol; 1-Chloro-3-fluoroisopropanol; 1-chloro-3-fluoropropan-2-ol |
| Moleküler Formülü |
C3H6ClFO |
| Molekül A??rl??? |
112.5305 |
| InChI |
InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| CAS kay?t numaras? |
453-11-2 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.212g/cm3 |
| Kaynama noktas? |
158.1°C at 760 mmHg |
| K?r?lma indisi |
1.399 |
| Alevlenme noktas? |
49.4°C |
| Buhar bas?nc? |
0.951mmHg at 25°C |
| Risk Kodlar? |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|