ChemNet > CAS > 453-11-2 1-Chloro-3-fluoro-2-propanol
453-11-2 1-Chloro-3-fluoro-2-propanol
| produktnavn |
1-Chloro-3-fluoro-2-propanol |
| Engelsk navn |
1-Chloro-3-fluoro-2-propanol; 1-Chloro-3-fluoroisopropanol; 1-chloro-3-fluoropropan-2-ol |
| Molekyl?r Formel |
C3H6ClFO |
| Molekylvekt |
112.5305 |
| InChI |
InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| CAS-nummer |
453-11-2 |
| Molecular Structure |
|
| Tetthet |
1.212g/cm3 |
| Kokepunkt |
158.1°C at 760 mmHg |
| Brytningsindeks |
1.399 |
| Flammepunktet |
49.4°C |
| Damptrykk |
0.951mmHg at 25°C |
| Risiko Koder |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Sikkerhet Beskrivelse |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|