ChemNet > CAS > 4521-31-7 2-Mercaptobenzyl alcohol
4521-31-7 2-Mercaptobenzyl alcohol
| ürün Ad? |
2-Mercaptobenzyl alcohol |
| ingilizce ad? |
2-Mercaptobenzyl alcohol; 2-(Hydroxymethyl)thiophenol; O-Mercaptobenzyl alcohol; (2-Sulfanylphenyl)methanol; 2- Mercaptobenzyl alcohol, tech.
; 2-(hydroxymethyl)benzenethiolate |
| Moleküler Formülü |
C7H7OS |
| Molekül A??rl??? |
139.1954 |
| InChI |
InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
| CAS kay?t numaras? |
4521-31-7 |
| Moleküler Yap?s? |
|
| Ergime noktas? |
31-32℃ |
| Kaynama noktas? |
276.5°C at 760 mmHg |
| Alevlenme noktas? |
121°C |
| Buhar bas?nc? |
0.00231mmHg at 25°C |
| Risk Kodlar? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|