ChemNet > CAS > 4521-31-7 2-Mercaptobenzyl alcohol
4521-31-7 2-Mercaptobenzyl alcohol
| Produkt-Name |
2-Mercaptobenzyl alcohol |
| Englischer Name |
2-Mercaptobenzyl alcohol; 2-(Hydroxymethyl)thiophenol; O-Mercaptobenzyl alcohol; (2-Sulfanylphenyl)methanol; 2- Mercaptobenzyl alcohol, tech.
; 2-(hydroxymethyl)benzenethiolate |
| Molekulare Formel |
C7H7OS |
| Molecular Weight |
139.1954 |
| InChI |
InChI=1/C7H8OS/c8-5-6-3-1-2-4-7(6)9/h1-4,8-9H,5H2/p-1 |
| CAS Registry Number |
4521-31-7 |
| Molecular Structure |
|
| Schmelzpunkt |
31-32℃ |
| Siedepunkt |
276.5°C at 760 mmHg |
| Flammpunkt |
121°C |
| Dampfdruck |
0.00231mmHg at 25°C |
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|