ChemNet > CAS > 3556-83-0 Methyl 3-methoxy-4-methylbenzoate
3556-83-0 Methyl 3-methoxy-4-methylbenzoate
| ürün Ad? |
Methyl 3-methoxy-4-methylbenzoate |
| ingilizce ad? |
Methyl 3-methoxy-4-methylbenzoate; 3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
| Moleküler Formülü |
C10H12O3 |
| Molekül A??rl??? |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
| CAS kay?t numaras? |
3556-83-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.075g/cm3 |
| Ergime noktas? |
50-120℃ |
| Kaynama noktas? |
269.5°C at 760 mmHg |
| K?r?lma indisi |
1.502 |
| Alevlenme noktas? |
107.5°C |
| Buhar bas?nc? |
0.00723mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|