ChemNet > CAS > 3556-83-0 Methyl 3-methoxy-4-methylbenzoate
3556-83-0 Methyl 3-methoxy-4-methylbenzoate
| Produkt-Name |
Methyl 3-methoxy-4-methylbenzoate |
| Englischer Name |
Methyl 3-methoxy-4-methylbenzoate; 3-Methoxy-4-methylbenzoic acid methyl ester; 3-Methoxy-p-toluic acid methyl ester (COOCH3=1); methyl 4-methoxy-3-methylbenzoate |
| Molekulare Formel |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-7-6-8(10(11)13-3)4-5-9(7)12-2/h4-6H,1-3H3 |
| CAS Registry Number |
3556-83-0 |
| Molecular Structure |
|
| Dichte |
1.075g/cm3 |
| Schmelzpunkt |
50-120℃ |
| Siedepunkt |
269.5°C at 760 mmHg |
| Brechungsindex |
1.502 |
| Flammpunkt |
107.5°C |
| Dampfdruck |
0.00723mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|