344-14-9 dimethyl fluoromalonate
| ürün Ad? |
dimethyl fluoromalonate |
| ingilizce ad? |
dimethyl fluoromalonate; Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester; Dimethyl 2-Fluoromalonate |
| Moleküler Formülü |
C5H7FO4 |
| Molekül A??rl??? |
150.1051 |
| InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| CAS kay?t numaras? |
344-14-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.211g/cm3 |
| Kaynama noktas? |
140.3°C at 760 mmHg |
| K?r?lma indisi |
1.382 |
| Alevlenme noktas? |
38.4°C |
| Buhar bas?nc? |
6.18mmHg at 25°C |
| Risk Kodlar? |
R34:Causes burns.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|