344-14-9 dimethyl fluoromalonate
| ?????? ?? ??? |
dimethyl fluoromalonate |
| ???????? ??? |
dimethyl fluoromalonate; Fluoromalonic acid dimethyl ester; dimethyl fluoropropanedioate; 2-Fluoro-malonic acid dimethyl ester; Dimethyl 2-Fluoromalonate |
| ????? ???????? |
C5H7FO4 |
| ?????? ??? |
150.1051 |
| InChI |
InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| ??? ??????? ?????? |
344-14-9 |
| ????? ?????? |
|
| ????? |
1.211g/cm3 |
| ????? ?? ??? |
140.3°C at 760 mmHg |
| ??????? ??????? |
1.382 |
| ????? ??????? |
38.4°C |
| ????? ?? ???? |
6.18mmHg at 25°C |
| ???? ?? ??? |
R34:Causes burns.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|